C8H11N3OS — CID 122236766
N',N'-dimethyl-2-sulfanylidene-1H-pyridine-3-carbohydrazide (PubChem CID 122236766) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is N',N'-dimethyl-2-sulfanylidene-1H-pyridine-3-carbohydrazide.
| Compound Name | N',N'-dimethyl-2-sulfanylidene-1H-pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 122236766 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | N',N'-dimethyl-2-sulfanylidene-1H-pyridine-3-carbohydrazide |
| SMILES | CN(C)NC(=O)c1ccc[nH]c1=S |
| InChI | InChI=1S/C8H11N3OS/c1-11(2)10-7(12)6-4-3-5-9-8(6)13/h3-5H,1-2H3,(H,9,13)(H,10,12) |
| InChIKey | IXMIJUUYWQQJMN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|