C9H11CmN2OS- — CID 170637453
curium;N-propyl-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 170637453) has the molecular formula C9H11CmN2OS- and a molecular weight of 442.27 g/mol. Its IUPAC name is curium;N-propyl-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | curium;N-propyl-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170637453 |
| Molecular Formula | C9H11CmN2OS- |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | curium;N-propyl-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | C[CH-]CNC(=O)c1ccc[nH]c1=S.[Cm] |
| InChI | InChI=1S/C9H11N2OS.Cm/c1-2-5-10-8(12)7-4-3-6-11-9(7)13;/h2-4,6H,5H2,1H3,(H,10,12)(H,11,13);/q-1; |
| InChIKey | PWTIOALGHDXMIV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|