C8H7F3N2OS — CID 18167685
2-sulfanylidene-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide (PubChem CID 18167685) has the molecular formula C8H7F3N2OS and a molecular weight of 236.22 g/mol. Its IUPAC name is 2-sulfanylidene-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide.
| Compound Name | 2-sulfanylidene-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 18167685 |
| Molecular Formula | C8H7F3N2OS |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 2-sulfanylidene-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc[nH]c1=S |
| InChI | InChI=1S/C8H7F3N2OS/c9-8(10,11)4-13-6(14)5-2-1-3-12-7(5)15/h1-3H,4H2,(H,12,15)(H,13,14) |
| InChIKey | OLVLRFNJDYUFFX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|