C12H14F3N3OS — CID 47140710
(2-sulfanylidene-1H-pyridin-3-yl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone (PubChem CID 47140710) has the molecular formula C12H14F3N3OS and a molecular weight of 305.32 g/mol. Its IUPAC name is (2-sulfanylidene-1H-pyridin-3-yl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone.
| Compound Name | (2-sulfanylidene-1H-pyridin-3-yl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 47140710 |
| Molecular Formula | C12H14F3N3OS |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (2-sulfanylidene-1H-pyridin-3-yl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc[nH]c1=S)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H14F3N3OS/c13-12(14,15)8-17-4-6-18(7-5-17)11(19)9-2-1-3-16-10(9)20/h1-3H,4-8H2,(H,16,20) |
| InChIKey | PUWOMCDDAZSZCH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|