C9H9F3N2OS — CID 107017754
2-oxo-1-(3,3,3-trifluoropropyl)pyridine-3-carbothioamide (PubChem CID 107017754) has the molecular formula C9H9F3N2OS and a molecular weight of 250.24 g/mol. Its IUPAC name is 2-oxo-1-(3,3,3-trifluoropropyl)pyridine-3-carbothioamide.
| Compound Name | 2-oxo-1-(3,3,3-trifluoropropyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107017754 |
| Molecular Formula | C9H9F3N2OS |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2-oxo-1-(3,3,3-trifluoropropyl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccn(CCC(F)(F)F)c1=O |
| InChI | InChI=1S/C9H9F3N2OS/c10-9(11,12)3-5-14-4-1-2-6(7(13)16)8(14)15/h1-2,4H,3,5H2,(H2,13,16) |
| InChIKey | YZXPCBWMLOYASF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|