C9H11FN2OS — CID 107017739
1-(3-fluoropropyl)-2-oxopyridine-3-carbothioamide (PubChem CID 107017739) has the molecular formula C9H11FN2OS and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-2-oxopyridine-3-carbothioamide.
| Compound Name | 1-(3-fluoropropyl)-2-oxopyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107017739 |
| Molecular Formula | C9H11FN2OS |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 1-(3-fluoropropyl)-2-oxopyridine-3-carbothioamide |
| SMILES | NC(=S)c1cccn(CCCF)c1=O |
| InChI | InChI=1S/C9H11FN2OS/c10-4-2-6-12-5-1-3-7(8(11)14)9(12)13/h1,3,5H,2,4,6H2,(H2,11,14) |
| InChIKey | NTWGQUSFPKOEMO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|