C9H17N3O2 — CID 122237455
4-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-3-methylpiperazin-2-one (PubChem CID 122237455) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-3-methylpiperazin-2-one.
| Compound Name | 4-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 122237455 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 4-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C9H17N3O2/c1-6-9(14)11-2-3-12(6)7-4-10-5-8(7)13/h6-8,10,13H,2-5H2,1H3,(H,11,14)/t6?,7-,8-/m1/s1 |
| InChIKey | QDXFBIWTTDGXCZ-SPDVFEMOSA-N |
| XLogP | -1.86 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |