C7H14FN — CID 122239975
2-fluoro-N,4-dimethylpent-4-en-1-amine (PubChem CID 122239975) has the molecular formula C7H14FN and a molecular weight of 131.19 g/mol. Its IUPAC name is 2-fluoro-N,4-dimethylpent-4-en-1-amine.
| Compound Name | 2-fluoro-N,4-dimethylpent-4-en-1-amine |
|---|---|
| PubChem CID | 122239975 |
| Molecular Formula | C7H14FN |
| Molecular Weight | 131.19 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | 2-fluoro-N,4-dimethylpent-4-en-1-amine |
| SMILES | C=C(C)CC(F)CNC |
| InChI | InChI=1S/C7H14FN/c1-6(2)4-7(8)5-9-3/h7,9H,1,4-5H2,2-3H3 |
| InChIKey | AROKPLFDUGCNLA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|