C14H24ClNO — CID 122240236
N,2,2-trimethyl-4-phenylmethoxybutan-1-amine;hydrochloride (PubChem CID 122240236) has the molecular formula C14H24ClNO and a molecular weight of 257.81 g/mol. Its IUPAC name is N,2,2-trimethyl-4-phenylmethoxybutan-1-amine;hydrochloride.
| Compound Name | N,2,2-trimethyl-4-phenylmethoxybutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 122240236 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.81 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N,2,2-trimethyl-4-phenylmethoxybutan-1-amine;hydrochloride |
| SMILES | CNCC(C)(C)CCOCc1ccccc1.Cl |
| InChI | InChI=1S/C14H23NO.ClH/c1-14(2,12-15-3)9-10-16-11-13-7-5-4-6-8-13;/h4-8,15H,9-12H2,1-3H3;1H |
| InChIKey | OFNSQKCBIDGAMU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|