C14H15ClN4O2S — CID 122243488
[3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 122243488) has the molecular formula C14H15ClN4O2S and a molecular weight of 338.82 g/mol. Its IUPAC name is [3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | [3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 122243488 |
| Molecular Formula | C14H15ClN4O2S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1CCCC(Oc2ccncc2Cl)C1 |
| InChI | InChI=1S/C14H15ClN4O2S/c1-9-13(22-18-17-9)14(20)19-6-2-3-10(8-19)21-12-4-5-16-7-11(12)15/h4-5,7,10H,2-3,6,8H2,1H3 |
| InChIKey | MMEKZNNNPSLECS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |