C21H26ClN3O2 — CID 122256407
[3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-[4-(diethylamino)phenyl]methanone (PubChem CID 122256407) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is [3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-[4-(diethylamino)phenyl]methanone.
| Compound Name | [3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-[4-(diethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 122256407 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | [3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-[4-(diethylamino)phenyl]methanone |
| SMILES | CCN(CC)c1ccc(C(=O)N2CCCC(Oc3ccncc3Cl)C2)cc1 |
| InChI | InChI=1S/C21H26ClN3O2/c1-3-24(4-2)17-9-7-16(8-10-17)21(26)25-13-5-6-18(15-25)27-20-11-12-23-14-19(20)22/h7-12,14,18H,3-6,13,15H2,1-2H3 |
| InChIKey | NGSHECZUTYRANX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |