C17H16ClIN2O2 — CID 122256358
[3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-(3-iodophenyl)methanone (PubChem CID 122256358) has the molecular formula C17H16ClIN2O2 and a molecular weight of 442.68 g/mol. Its IUPAC name is [3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-(3-iodophenyl)methanone.
| Compound Name | [3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-(3-iodophenyl)methanone |
|---|---|
| PubChem CID | 122256358 |
| Molecular Formula | C17H16ClIN2O2 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | [3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-(3-iodophenyl)methanone |
| SMILES | O=C(c1cccc(I)c1)N1CCCC(Oc2ccncc2Cl)C1 |
| InChI | InChI=1S/C17H16ClIN2O2/c18-15-10-20-7-6-16(15)23-14-5-2-8-21(11-14)17(22)12-3-1-4-13(19)9-12/h1,3-4,6-7,9-10,14H,2,5,8,11H2 |
| InChIKey | LISTYBUCLGEGSH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|