C19H18ClNO3S2 — CID 122244303
3-chloro-N-[2-hydroxy-2-(4-thiophen-3-ylphenyl)ethyl]-2-methylbenzenesulfonamide (PubChem CID 122244303) has the molecular formula C19H18ClNO3S2 and a molecular weight of 407.94 g/mol. Its IUPAC name is 3-chloro-N-[2-hydroxy-2-(4-thiophen-3-ylphenyl)ethyl]-2-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[2-hydroxy-2-(4-thiophen-3-ylphenyl)ethyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122244303 |
| Molecular Formula | C19H18ClNO3S2 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 3-chloro-N-[2-hydroxy-2-(4-thiophen-3-ylphenyl)ethyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)NCC(O)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C19H18ClNO3S2/c1-13-17(20)3-2-4-19(13)26(23,24)21-11-18(22)15-7-5-14(6-8-15)16-9-10-25-12-16/h2-10,12,18,21-22H,11H2,1H3 |
| InChIKey | DAHMTLAHNIWKJL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |