C16H13N7OS — CID 122245691
2-phenyl-N-[(1-thiophen-2-yltriazol-4-yl)methyl]triazole-4-carboxamide (PubChem CID 122245691) has the molecular formula C16H13N7OS and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-phenyl-N-[(1-thiophen-2-yltriazol-4-yl)methyl]triazole-4-carboxamide.
| Compound Name | 2-phenyl-N-[(1-thiophen-2-yltriazol-4-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 122245691 |
| Molecular Formula | C16H13N7OS |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-phenyl-N-[(1-thiophen-2-yltriazol-4-yl)methyl]triazole-4-carboxamide |
| SMILES | O=C(NCc1cn(-c2cccs2)nn1)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H13N7OS/c24-16(14-10-18-23(20-14)13-5-2-1-3-6-13)17-9-12-11-22(21-19-12)15-7-4-8-25-15/h1-8,10-11H,9H2,(H,17,24) |
| InChIKey | NFQOAHYRHPHTOB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |