C17H14F3N3O4 — CID 122247534
(4-methyl-3-nitrophenyl)-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone (PubChem CID 122247534) has the molecular formula C17H14F3N3O4 and a molecular weight of 381.31 g/mol. Its IUPAC name is (4-methyl-3-nitrophenyl)-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone.
| Compound Name | (4-methyl-3-nitrophenyl)-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 122247534 |
| Molecular Formula | C17H14F3N3O4 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (4-methyl-3-nitrophenyl)-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CC(Oc3ccc(C(F)(F)F)cn3)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14F3N3O4/c1-10-2-3-11(6-14(10)23(25)26)16(24)22-8-13(9-22)27-15-5-4-12(7-21-15)17(18,19)20/h2-7,13H,8-9H2,1H3 |
| InChIKey | LYCKGUKBWMTMQH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|