C16H15ClFN3O2 — CID 122248114
3-[(3-chloro-2-pyridinyl)oxy]-N-[(4-fluorophenyl)methyl]azetidine-1-carboxamide (PubChem CID 122248114) has the molecular formula C16H15ClFN3O2 and a molecular weight of 335.77 g/mol. Its IUPAC name is 3-[(3-chloro-2-pyridinyl)oxy]-N-[(4-fluorophenyl)methyl]azetidine-1-carboxamide.
| Compound Name | 3-[(3-chloro-2-pyridinyl)oxy]-N-[(4-fluorophenyl)methyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 122248114 |
| Molecular Formula | C16H15ClFN3O2 |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3-[(3-chloro-2-pyridinyl)oxy]-N-[(4-fluorophenyl)methyl]azetidine-1-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)N1CC(Oc2ncccc2Cl)C1 |
| InChI | InChI=1S/C16H15ClFN3O2/c17-14-2-1-7-19-15(14)23-13-9-21(10-13)16(22)20-8-11-3-5-12(18)6-4-11/h1-7,13H,8-10H2,(H,20,22) |
| InChIKey | YEPDKNCEJJAYDI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |