C14H11N3O2S — CID 122249236
2-[1-(thiophene-3-carbonyl)azetidin-3-yl]oxypyridine-3-carbonitrile (PubChem CID 122249236) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-[1-(thiophene-3-carbonyl)azetidin-3-yl]oxypyridine-3-carbonitrile.
| Compound Name | 2-[1-(thiophene-3-carbonyl)azetidin-3-yl]oxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 122249236 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[1-(thiophene-3-carbonyl)azetidin-3-yl]oxypyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1OC1CN(C(=O)c2ccsc2)C1 |
| InChI | InChI=1S/C14H11N3O2S/c15-6-10-2-1-4-16-13(10)19-12-7-17(8-12)14(18)11-3-5-20-9-11/h1-5,9,12H,7-8H2 |
| InChIKey | OAMHKWBDWKXFGN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |