C10H11N3O3S — CID 122249319
2-(1-methylsulfonylazetidin-3-yl)oxypyridine-3-carbonitrile (PubChem CID 122249319) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 2-(1-methylsulfonylazetidin-3-yl)oxypyridine-3-carbonitrile.
| Compound Name | 2-(1-methylsulfonylazetidin-3-yl)oxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 122249319 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-(1-methylsulfonylazetidin-3-yl)oxypyridine-3-carbonitrile |
| SMILES | CS(=O)(=O)N1CC(Oc2ncccc2C#N)C1 |
| InChI | InChI=1S/C10H11N3O3S/c1-17(14,15)13-6-9(7-13)16-10-8(5-11)3-2-4-12-10/h2-4,9H,6-7H2,1H3 |
| InChIKey | TZXSQGIUOUKDKG-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |