C16H12F3IN2O2 — CID 122251000
(3-iodophenyl)-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone (PubChem CID 122251000) has the molecular formula C16H12F3IN2O2 and a molecular weight of 448.18 g/mol. Its IUPAC name is (3-iodophenyl)-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone.
| Compound Name | (3-iodophenyl)-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 122251000 |
| Molecular Formula | C16H12F3IN2O2 |
| Molecular Weight | 448.18 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | (3-iodophenyl)-[3-[[3-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
| SMILES | O=C(c1cccc(I)c1)N1CC(Oc2ncccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H12F3IN2O2/c17-16(18,19)13-5-2-6-21-14(13)24-12-8-22(9-12)15(23)10-3-1-4-11(20)7-10/h1-7,12H,8-9H2 |
| InChIKey | RFJPCXGNFSBSFP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|