C16H14ClF3N2O3S — CID 122251179
2-[1-[(4-chlorophenyl)methylsulfonyl]azetidin-3-yl]oxy-3-(trifluoromethyl)pyridine (PubChem CID 122251179) has the molecular formula C16H14ClF3N2O3S and a molecular weight of 406.81 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methylsulfonyl]azetidin-3-yl]oxy-3-(trifluoromethyl)pyridine.
| Compound Name | 2-[1-[(4-chlorophenyl)methylsulfonyl]azetidin-3-yl]oxy-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 122251179 |
| Molecular Formula | C16H14ClF3N2O3S |
| Molecular Weight | 406.81 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methylsulfonyl]azetidin-3-yl]oxy-3-(trifluoromethyl)pyridine |
| SMILES | O=S(=O)(Cc1ccc(Cl)cc1)N1CC(Oc2ncccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H14ClF3N2O3S/c17-12-5-3-11(4-6-12)10-26(23,24)22-8-13(9-22)25-15-14(16(18,19)20)2-1-7-21-15/h1-7,13H,8-10H2 |
| InChIKey | AOEVFKWRCBOCIH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.81 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |