C18H14F3N5O2 — CID 122251211
(2-phenyltriazol-4-yl)-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone (PubChem CID 122251211) has the molecular formula C18H14F3N5O2 and a molecular weight of 389.34 g/mol. Its IUPAC name is (2-phenyltriazol-4-yl)-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone.
| Compound Name | (2-phenyltriazol-4-yl)-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 122251211 |
| Molecular Formula | C18H14F3N5O2 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | (2-phenyltriazol-4-yl)-[3-[[4-(trifluoromethyl)-2-pyridinyl]oxy]azetidin-1-yl]methanone |
| SMILES | O=C(c1cnn(-c2ccccc2)n1)N1CC(Oc2cc(C(F)(F)F)ccn2)C1 |
| InChI | InChI=1S/C18H14F3N5O2/c19-18(20,21)12-6-7-22-16(8-12)28-14-10-25(11-14)17(27)15-9-23-26(24-15)13-4-2-1-3-5-13/h1-9,14H,10-11H2 |
| InChIKey | ASUUVFWZRLXYBJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |