C20H20ClN3O2S — CID 122256424
1-[3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-2-(1H-indol-3-ylsulfanyl)ethanone (PubChem CID 122256424) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is 1-[3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-2-(1H-indol-3-ylsulfanyl)ethanone.
| Compound Name | 1-[3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-2-(1H-indol-3-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 122256424 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 1-[3-[(3-chloro-4-pyridinyl)oxy]piperidin-1-yl]-2-(1H-indol-3-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1c[nH]c2ccccc12)N1CCCC(Oc2ccncc2Cl)C1 |
| InChI | InChI=1S/C20H20ClN3O2S/c21-16-10-22-8-7-18(16)26-14-4-3-9-24(12-14)20(25)13-27-19-11-23-17-6-2-1-5-15(17)19/h1-2,5-8,10-11,14,23H,3-4,9,12-13H2 |
| InChIKey | AINBHIBFGLGCBM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |