C19H23N3O5S — CID 122257087
4-[1-(4-ethoxyphenyl)sulfonylpiperidin-3-yl]oxypyridine-2-carboxamide (PubChem CID 122257087) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-[1-(4-ethoxyphenyl)sulfonylpiperidin-3-yl]oxypyridine-2-carboxamide.
| Compound Name | 4-[1-(4-ethoxyphenyl)sulfonylpiperidin-3-yl]oxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 122257087 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 4-[1-(4-ethoxyphenyl)sulfonylpiperidin-3-yl]oxypyridine-2-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCCC(Oc3ccnc(C(N)=O)c3)C2)cc1 |
| InChI | InChI=1S/C19H23N3O5S/c1-2-26-14-5-7-17(8-6-14)28(24,25)22-11-3-4-16(13-22)27-15-9-10-21-18(12-15)19(20)23/h5-10,12,16H,2-4,11,13H2,1H3,(H2,20,23) |
| InChIKey | GFKHFICWZNGPIB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |