C18H19ClN4O4 — CID 122260280
(2-chloro-5-nitrophenyl)-[3-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]methanone (PubChem CID 122260280) has the molecular formula C18H19ClN4O4 and a molecular weight of 390.83 g/mol. Its IUPAC name is (2-chloro-5-nitrophenyl)-[3-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]methanone.
| Compound Name | (2-chloro-5-nitrophenyl)-[3-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 122260280 |
| Molecular Formula | C18H19ClN4O4 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (2-chloro-5-nitrophenyl)-[3-(2,6-dimethylpyrimidin-4-yl)oxypiperidin-1-yl]methanone |
| SMILES | Cc1cc(OC2CCCN(C(=O)c3cc([N+](=O)[O-])ccc3Cl)C2)nc(C)n1 |
| InChI | InChI=1S/C18H19ClN4O4/c1-11-8-17(21-12(2)20-11)27-14-4-3-7-22(10-14)18(24)15-9-13(23(25)26)5-6-16(15)19/h5-6,8-9,14H,3-4,7,10H2,1-2H3 |
| InChIKey | HGAUWVRFPSNSNL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|