C15H13F2N3O — CID 122263855
N-[(6-cyclopropylpyrimidin-4-yl)methyl]-3,4-difluorobenzamide (PubChem CID 122263855) has the molecular formula C15H13F2N3O and a molecular weight of 289.29 g/mol. Its IUPAC name is N-[(6-cyclopropylpyrimidin-4-yl)methyl]-3,4-difluorobenzamide.
| Compound Name | N-[(6-cyclopropylpyrimidin-4-yl)methyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 122263855 |
| Molecular Formula | C15H13F2N3O |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[(6-cyclopropylpyrimidin-4-yl)methyl]-3,4-difluorobenzamide |
| SMILES | O=C(NCc1cc(C2CC2)ncn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H13F2N3O/c16-12-4-3-10(5-13(12)17)15(21)18-7-11-6-14(9-1-2-9)20-8-19-11/h3-6,8-9H,1-2,7H2,(H,18,21) |
| InChIKey | LPTNRBKAQKCJES-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |