C15H15ClN4O — CID 122264066
1-(3-chlorophenyl)-3-[(6-cyclopropylpyrimidin-4-yl)methyl]urea (PubChem CID 122264066) has the molecular formula C15H15ClN4O and a molecular weight of 302.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(6-cyclopropylpyrimidin-4-yl)methyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(6-cyclopropylpyrimidin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 122264066 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(6-cyclopropylpyrimidin-4-yl)methyl]urea |
| SMILES | O=C(NCc1cc(C2CC2)ncn1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H15ClN4O/c16-11-2-1-3-12(6-11)20-15(21)17-8-13-7-14(10-4-5-10)19-9-18-13/h1-3,6-7,9-10H,4-5,8H2,(H2,17,20,21) |
| InChIKey | KOCSKLSISMAHEL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |