C17H20N4O — CID 122264075
1-[(6-cyclopropylpyrimidin-4-yl)methyl]-3-(2-ethylphenyl)urea (PubChem CID 122264075) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-[(6-cyclopropylpyrimidin-4-yl)methyl]-3-(2-ethylphenyl)urea.
| Compound Name | 1-[(6-cyclopropylpyrimidin-4-yl)methyl]-3-(2-ethylphenyl)urea |
|---|---|
| PubChem CID | 122264075 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-[(6-cyclopropylpyrimidin-4-yl)methyl]-3-(2-ethylphenyl)urea |
| SMILES | CCc1ccccc1NC(=O)NCc1cc(C2CC2)ncn1 |
| InChI | InChI=1S/C17H20N4O/c1-2-12-5-3-4-6-15(12)21-17(22)18-10-14-9-16(13-7-8-13)20-11-19-14/h3-6,9,11,13H,2,7-8,10H2,1H3,(H2,18,21,22) |
| InChIKey | COVLVIGWJXWBMK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |