C22H23N5O4 — CID 122266273
N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]-N'-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]oxamide (PubChem CID 122266273) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]-N'-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]oxamide.
| Compound Name | N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]-N'-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 122266273 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[2-(furan-2-yl)-2-pyrazol-1-ylethyl]-N'-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCC(c2ccco2)n2cccn2)cc1N1CCCC1=O |
| InChI | InChI=1S/C22H23N5O4/c1-15-7-8-16(13-17(15)26-10-2-6-20(26)28)25-22(30)21(29)23-14-18(19-5-3-12-31-19)27-11-4-9-24-27/h3-5,7-9,11-13,18H,2,6,10,14H2,1H3,(H,23,29)(H,25,30) |
| InChIKey | KUGHUZYLNAUOPD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|