About oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate
oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate (PubChem CID 122267770) has the molecular formula C16H20F3N3O4
and a molecular weight of 375.35 g/mol. Its IUPAC name is oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate.
Molecular Properties
| Compound Name | oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate |
| PubChem CID | 122267770 |
| Molecular Formula | C16H20F3N3O4 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate |
| SMILES | O=C(OC1CCOCC1)N1CCCC(Oc2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C16H20F3N3O4/c17-16(18,19)13-3-6-20-14(21-13)25-12-2-1-7-22(10-12)15(23)26-11-4-8-24-9-5-11/h3,6,11-12H,1-2,4-5,7-10H2 |
| InChIKey | JDEIDNKRXBPMJO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate?
The IUPAC name of oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate (CID 122267770) is oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate.
What is the SMILES notation for oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate?
The canonical SMILES for oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate is O=C(OC1CCOCC1)N1CCCC(Oc2nccc(C(F)(F)F)n2)C1.
What is the InChIKey of oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate?
The InChIKey is JDEIDNKRXBPMJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F3N3O4/c17-16(18,19)13-3-6-20-14(21-13)25-12-2-1-7-22(10-12)15(23)26-11-4-8-24-9-5-11/h3,6,11-12H,1-2,4-5,7-10H2.
What are the key properties of oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate?
oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate has a molecular weight of 375.35 g/mol, XLogP of 2.65, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl 3-[4-(trifluoromethyl)pyrimidin-2-yl]oxypiperidine-1-carboxylate is sourced from PubChem (CID 122267770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).