C21H28N4O3 — CID 122268253
[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]-[6-(2-methylpropoxy)-3-pyridinyl]methanone (PubChem CID 122268253) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is [3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]-[6-(2-methylpropoxy)-3-pyridinyl]methanone.
| Compound Name | [3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]-[6-(2-methylpropoxy)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 122268253 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | [3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]-[6-(2-methylpropoxy)-3-pyridinyl]methanone |
| SMILES | CCc1cnc(OC2CCCN(C(=O)c3ccc(OCC(C)C)nc3)C2)nc1 |
| InChI | InChI=1S/C21H28N4O3/c1-4-16-10-23-21(24-11-16)28-18-6-5-9-25(13-18)20(26)17-7-8-19(22-12-17)27-14-15(2)3/h7-8,10-12,15,18H,4-6,9,13-14H2,1-3H3 |
| InChIKey | RORLFHTWYJTVLP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |