C17H28N4O2 — CID 122268315
3-(5-ethylpyrimidin-2-yl)oxy-N-pentan-3-ylpiperidine-1-carboxamide (PubChem CID 122268315) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-(5-ethylpyrimidin-2-yl)oxy-N-pentan-3-ylpiperidine-1-carboxamide.
| Compound Name | 3-(5-ethylpyrimidin-2-yl)oxy-N-pentan-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 122268315 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-(5-ethylpyrimidin-2-yl)oxy-N-pentan-3-ylpiperidine-1-carboxamide |
| SMILES | CCc1cnc(OC2CCCN(C(=O)NC(CC)CC)C2)nc1 |
| InChI | InChI=1S/C17H28N4O2/c1-4-13-10-18-16(19-11-13)23-15-8-7-9-21(12-15)17(22)20-14(5-2)6-3/h10-11,14-15H,4-9,12H2,1-3H3,(H,20,22) |
| InChIKey | ZCWKYWFINFSLHV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |