C18H20Cl2N4O2 — CID 122268297
N-(3,4-dichlorophenyl)-3-(5-ethylpyrimidin-2-yl)oxypiperidine-1-carboxamide (PubChem CID 122268297) has the molecular formula C18H20Cl2N4O2 and a molecular weight of 395.29 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(5-ethylpyrimidin-2-yl)oxypiperidine-1-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(5-ethylpyrimidin-2-yl)oxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 122268297 |
| Molecular Formula | C18H20Cl2N4O2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(5-ethylpyrimidin-2-yl)oxypiperidine-1-carboxamide |
| SMILES | CCc1cnc(OC2CCCN(C(=O)Nc3ccc(Cl)c(Cl)c3)C2)nc1 |
| InChI | InChI=1S/C18H20Cl2N4O2/c1-2-12-9-21-17(22-10-12)26-14-4-3-7-24(11-14)18(25)23-13-5-6-15(19)16(20)8-13/h5-6,8-10,14H,2-4,7,11H2,1H3,(H,23,25) |
| InChIKey | ZHZMRGQOIDYSOM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |