C20H21F2N3O2 — CID 122268255
(E)-3-(2,5-difluorophenyl)-1-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 122268255) has the molecular formula C20H21F2N3O2 and a molecular weight of 373.40 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-1-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-difluorophenyl)-1-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122268255 |
| Molecular Formula | C20H21F2N3O2 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-1-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | CCc1cnc(OC2CCCN(C(=O)/C=C/c3cc(F)ccc3F)C2)nc1 |
| InChI | InChI=1S/C20H21F2N3O2/c1-2-14-11-23-20(24-12-14)27-17-4-3-9-25(13-17)19(26)8-5-15-10-16(21)6-7-18(15)22/h5-8,10-12,17H,2-4,9,13H2,1H3/b8-5+ |
| InChIKey | HMXLBQGVPKMYOH-VMPITWQZSA-N |
| XLogP | 3.40 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|