C16H20N2O4S2 — CID 122272766
(4-morpholin-4-ylsulfonylphenyl)-(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)methanone (PubChem CID 122272766) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is (4-morpholin-4-ylsulfonylphenyl)-(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)methanone.
| Compound Name | (4-morpholin-4-ylsulfonylphenyl)-(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)methanone |
|---|---|
| PubChem CID | 122272766 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (4-morpholin-4-ylsulfonylphenyl)-(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCOCC2)cc1)N1CC2CC1CS2 |
| InChI | InChI=1S/C16H20N2O4S2/c19-16(18-10-14-9-13(18)11-23-14)12-1-3-15(4-2-12)24(20,21)17-5-7-22-8-6-17/h1-4,13-14H,5-11H2 |
| InChIKey | CKEMMVXEELHIOX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |