C15H23N3O4 — CID 122276478
4-ethyl-N-(7-oxaspiro[3.5]nonan-3-yl)-2,3-dioxopiperazine-1-carboxamide (PubChem CID 122276478) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-ethyl-N-(7-oxaspiro[3.5]nonan-3-yl)-2,3-dioxopiperazine-1-carboxamide.
| Compound Name | 4-ethyl-N-(7-oxaspiro[3.5]nonan-3-yl)-2,3-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 122276478 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 4-ethyl-N-(7-oxaspiro[3.5]nonan-3-yl)-2,3-dioxopiperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NC2CCC23CCOCC3)C(=O)C1=O |
| InChI | InChI=1S/C15H23N3O4/c1-2-17-7-8-18(13(20)12(17)19)14(21)16-11-3-4-15(11)5-9-22-10-6-15/h11H,2-10H2,1H3,(H,16,21) |
| InChIKey | DYXPEUJJAFVYJQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|