C18H30N4O3S — CID 126854572
4-ethyl-2,3-dioxo-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]piperazine-1-carboxamide (PubChem CID 126854572) has the molecular formula C18H30N4O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is 4-ethyl-2,3-dioxo-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-ethyl-2,3-dioxo-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 126854572 |
| Molecular Formula | C18H30N4O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 4-ethyl-2,3-dioxo-N-[[1-(thian-4-yl)piperidin-4-yl]methyl]piperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NCC2CCN(C3CCSCC3)CC2)C(=O)C1=O |
| InChI | InChI=1S/C18H30N4O3S/c1-2-20-9-10-22(17(24)16(20)23)18(25)19-13-14-3-7-21(8-4-14)15-5-11-26-12-6-15/h14-15H,2-13H2,1H3,(H,19,25) |
| InChIKey | HBEYQRZBTRDDEO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|