C19H25F3N2OS — CID 91814223
N-[[1-(thian-4-yl)piperidin-4-yl]methyl]-3-(trifluoromethyl)benzamide (PubChem CID 91814223) has the molecular formula C19H25F3N2OS and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[[1-(thian-4-yl)piperidin-4-yl]methyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[[1-(thian-4-yl)piperidin-4-yl]methyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91814223 |
| Molecular Formula | C19H25F3N2OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[[1-(thian-4-yl)piperidin-4-yl]methyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1CCN(C2CCSCC2)CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H25F3N2OS/c20-19(21,22)16-3-1-2-15(12-16)18(25)23-13-14-4-8-24(9-5-14)17-6-10-26-11-7-17/h1-3,12,14,17H,4-11,13H2,(H,23,25) |
| InChIKey | BMGANKHKNDEEQC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |