C19H26N2O2S — CID 91919031
N-(cyclopropylmethyl)-3-[1-(thian-4-yl)azetidin-3-yl]oxybenzamide (PubChem CID 91919031) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-[1-(thian-4-yl)azetidin-3-yl]oxybenzamide.
| Compound Name | N-(cyclopropylmethyl)-3-[1-(thian-4-yl)azetidin-3-yl]oxybenzamide |
|---|---|
| PubChem CID | 91919031 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-(cyclopropylmethyl)-3-[1-(thian-4-yl)azetidin-3-yl]oxybenzamide |
| SMILES | O=C(NCC1CC1)c1cccc(OC2CN(C3CCSCC3)C2)c1 |
| InChI | InChI=1S/C19H26N2O2S/c22-19(20-11-14-4-5-14)15-2-1-3-17(10-15)23-18-12-21(13-18)16-6-8-24-9-7-16/h1-3,10,14,16,18H,4-9,11-13H2,(H,20,22) |
| InChIKey | YKBJEENEUVFJHD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |