C15H20FNO4S — CID 122276580
3-fluoro-4-methoxy-N-(7-oxaspiro[3.5]nonan-3-yl)benzenesulfonamide (PubChem CID 122276580) has the molecular formula C15H20FNO4S and a molecular weight of 329.39 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-(7-oxaspiro[3.5]nonan-3-yl)benzenesulfonamide.
| Compound Name | 3-fluoro-4-methoxy-N-(7-oxaspiro[3.5]nonan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 122276580 |
| Molecular Formula | C15H20FNO4S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-fluoro-4-methoxy-N-(7-oxaspiro[3.5]nonan-3-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CCC23CCOCC3)cc1F |
| InChI | InChI=1S/C15H20FNO4S/c1-20-13-3-2-11(10-12(13)16)22(18,19)17-14-4-5-15(14)6-8-21-9-7-15/h2-3,10,14,17H,4-9H2,1H3 |
| InChIKey | IIRLCHFZHFKNDC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |