C17H18FN3O2 — CID 122277170
4-fluoro-N-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]benzamide (PubChem CID 122277170) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is 4-fluoro-N-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 122277170 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-fluoro-N-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCn1nc2c(cc1=O)CCCC2)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3O2/c18-14-7-5-12(6-8-14)17(23)19-9-10-21-16(22)11-13-3-1-2-4-15(13)20-21/h5-8,11H,1-4,9-10H2,(H,19,23) |
| InChIKey | AAAOKBFOPFEDHK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |