C18H21N3O2 — CID 122277171
3-methyl-N-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]benzamide (PubChem CID 122277171) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 3-methyl-N-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]benzamide.
| Compound Name | 3-methyl-N-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 122277171 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3-methyl-N-[2-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)ethyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCCn2nc3c(cc2=O)CCCC3)c1 |
| InChI | InChI=1S/C18H21N3O2/c1-13-5-4-7-15(11-13)18(23)19-9-10-21-17(22)12-14-6-2-3-8-16(14)20-21/h4-5,7,11-12H,2-3,6,8-10H2,1H3,(H,19,23) |
| InChIKey | IRYDORZNIMYTEV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |