C18H24N4O — CID 122281316
cyclohex-3-en-1-yl-[4-(6,7-dihydro-5H-cyclopenta[c]pyridazin-3-yl)piperazin-1-yl]methanone (PubChem CID 122281316) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-[4-(6,7-dihydro-5H-cyclopenta[c]pyridazin-3-yl)piperazin-1-yl]methanone.
| Compound Name | cyclohex-3-en-1-yl-[4-(6,7-dihydro-5H-cyclopenta[c]pyridazin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122281316 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | cyclohex-3-en-1-yl-[4-(6,7-dihydro-5H-cyclopenta[c]pyridazin-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CC=CCC1)N1CCN(c2cc3c(nn2)CCC3)CC1 |
| InChI | InChI=1S/C18H24N4O/c23-18(14-5-2-1-3-6-14)22-11-9-21(10-12-22)17-13-15-7-4-8-16(15)19-20-17/h1-2,13-14H,3-12H2 |
| InChIKey | QVCVJZBKKIVEIB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|