C17H21N7O — CID 72719895
cyclohex-3-en-1-yl-[4-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]piperazin-1-yl]methanone (PubChem CID 72719895) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-[4-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]piperazin-1-yl]methanone.
| Compound Name | cyclohex-3-en-1-yl-[4-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 72719895 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | cyclohex-3-en-1-yl-[4-[6-(1,2,4-triazol-1-yl)pyridazin-3-yl]piperazin-1-yl]methanone |
| SMILES | O=C(C1CC=CCC1)N1CCN(c2ccc(-n3cncn3)nn2)CC1 |
| InChI | InChI=1S/C17H21N7O/c25-17(14-4-2-1-3-5-14)23-10-8-22(9-11-23)15-6-7-16(21-20-15)24-13-18-12-19-24/h1-2,6-7,12-14H,3-5,8-11H2 |
| InChIKey | KZAFBVREMVYIKK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|