C15H23N5O2 — CID 122281585
4-(6,7-dihydro-5H-cyclopenta[c]pyridazin-3-yl)-N-(2-methoxyethyl)piperazine-1-carboxamide (PubChem CID 122281585) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-(6,7-dihydro-5H-cyclopenta[c]pyridazin-3-yl)-N-(2-methoxyethyl)piperazine-1-carboxamide.
| Compound Name | 4-(6,7-dihydro-5H-cyclopenta[c]pyridazin-3-yl)-N-(2-methoxyethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122281585 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 4-(6,7-dihydro-5H-cyclopenta[c]pyridazin-3-yl)-N-(2-methoxyethyl)piperazine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCN(c2cc3c(nn2)CCC3)CC1 |
| InChI | InChI=1S/C15H23N5O2/c1-22-10-5-16-15(21)20-8-6-19(7-9-20)14-11-12-3-2-4-13(12)17-18-14/h11H,2-10H2,1H3,(H,16,21) |
| InChIKey | SEHGORHRUYSCDI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|