C15H18N4O2 — CID 122282164
benzyl 2-[[6-(dimethylamino)pyrimidin-4-yl]amino]acetate (PubChem CID 122282164) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is benzyl 2-[[6-(dimethylamino)pyrimidin-4-yl]amino]acetate.
| Compound Name | benzyl 2-[[6-(dimethylamino)pyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 122282164 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | benzyl 2-[[6-(dimethylamino)pyrimidin-4-yl]amino]acetate |
| SMILES | CN(C)c1cc(NCC(=O)OCc2ccccc2)ncn1 |
| InChI | InChI=1S/C15H18N4O2/c1-19(2)14-8-13(17-11-18-14)16-9-15(20)21-10-12-6-4-3-5-7-12/h3-8,11H,9-10H2,1-2H3,(H,16,17,18) |
| InChIKey | UUHIMGMQYADYKN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |