C17H18N6O — CID 122282953
N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 122282953) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 122282953 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[2-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cncn1)Nc1ccccc1-c1cn2c(n1)CCCC2 |
| InChI | InChI=1S/C17H18N6O/c24-17(10-23-12-18-11-19-23)21-14-6-2-1-5-13(14)15-9-22-8-4-3-7-16(22)20-15/h1-2,5-6,9,11-12H,3-4,7-8,10H2,(H,21,24) |
| InChIKey | PUNDJKBRXDGVRP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |