C18H21N3O2S — CID 122284854
N-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]butane-1-sulfonamide (PubChem CID 122284854) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]butane-1-sulfonamide.
| Compound Name | N-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 122284854 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[3-(7-methylimidazo[1,2-a]pyridin-2-yl)phenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1cccc(-c2cn3ccc(C)cc3n2)c1 |
| InChI | InChI=1S/C18H21N3O2S/c1-3-4-10-24(22,23)20-16-7-5-6-15(12-16)17-13-21-9-8-14(2)11-18(21)19-17/h5-9,11-13,20H,3-4,10H2,1-2H3 |
| InChIKey | USCREHBOQHSCAO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |