C25H23N5O2 — CID 122286682
(E)-3-(furan-2-yl)-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 122286682) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122286682 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[4-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(Nc3ccc(NC(=O)/C=C/c4ccco4)cc3)n2)cc1 |
| InChI | InChI=1S/C25H23N5O2/c1-17-5-7-19(8-6-17)27-23-16-18(2)26-25(30-23)29-21-11-9-20(10-12-21)28-24(31)14-13-22-4-3-15-32-22/h3-16H,1-2H3,(H,28,31)(H2,26,27,29,30)/b14-13+ |
| InChIKey | XTVGIABJWRPQJM-BUHFOSPRSA-N |
| XLogP | 5.83 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|