C25H25N5O3S — CID 122288208
N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]naphthalene-1-sulfonamide (PubChem CID 122288208) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]naphthalene-1-sulfonamide.
| Compound Name | N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 122288208 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]naphthalene-1-sulfonamide |
| SMILES | Cc1cc(N2CCOCC2)nc(Nc2ccc(NS(=O)(=O)c3cccc4ccccc34)cc2)n1 |
| InChI | InChI=1S/C25H25N5O3S/c1-18-17-24(30-13-15-33-16-14-30)28-25(26-18)27-20-9-11-21(12-10-20)29-34(31,32)23-8-4-6-19-5-2-3-7-22(19)23/h2-12,17,29H,13-16H2,1H3,(H,26,27,28) |
| InChIKey | RBFGIESLAJLOMN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |