C25H26N6O2 — CID 122288135
2-indol-1-yl-N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]acetamide (PubChem CID 122288135) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-indol-1-yl-N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]acetamide.
| Compound Name | 2-indol-1-yl-N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 122288135 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-indol-1-yl-N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]acetamide |
| SMILES | Cc1cc(N2CCOCC2)nc(Nc2ccc(NC(=O)Cn3ccc4ccccc43)cc2)n1 |
| InChI | InChI=1S/C25H26N6O2/c1-18-16-23(30-12-14-33-15-13-30)29-25(26-18)28-21-8-6-20(7-9-21)27-24(32)17-31-11-10-19-4-2-3-5-22(19)31/h2-11,16H,12-15,17H2,1H3,(H,27,32)(H,26,28,29) |
| InChIKey | XVJAUQPFILHTLU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |